C30H36O8 — CID 14485930
[18-acetyloxy-6-(furan-3-yl)-1,7,11,15,15-pentamethyl-5,14-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-12-en-17-yl] acetate (PubChem CID 14485930) has the molecular formula C30H36O8 and a molecular weight of 524.61 g/mol. Its IUPAC name is [18-acetyloxy-6-(furan-3-yl)-1,7,11,15,15-pentamethyl-5,14-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-12-en-17-yl] acetate.
| Compound Name | [18-acetyloxy-6-(furan-3-yl)-1,7,11,15,15-pentamethyl-5,14-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-12-en-17-yl] acetate |
|---|---|
| PubChem CID | 14485930 |
| Molecular Formula | C30H36O8 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | [18-acetyloxy-6-(furan-3-yl)-1,7,11,15,15-pentamethyl-5,14-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-12-en-17-yl] acetate |
| SMILES | CC(=O)OC1C2C(C)(C)C(=O)C=CC2(C)C2CCC3(C)C(c4ccoc4)C(=O)C4OC43C2(C)C1OC(C)=O |
| InChI | InChI=1S/C30H36O8/c1-15(31)36-22-23-26(3,4)19(33)9-11-27(23,5)18-8-12-28(6)20(17-10-13-35-14-17)21(34)24-30(28,38-24)29(18,7)25(22)37-16(2)32/h9-11,13-14,18,20,22-25H,8,12H2,1-7H3 |
| InChIKey | XPZIMHGZVQDLNZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 112.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|