C28H36O6 — CID 137323257
[(1S,4S,11R,18R)-6-(furan-3-yl)-1,7,11,15,15-pentamethyl-5,14-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-18-yl] acetate (PubChem CID 137323257) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is [(1S,4S,11R,18R)-6-(furan-3-yl)-1,7,11,15,15-pentamethyl-5,14-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-18-yl] acetate.
| Compound Name | [(1S,4S,11R,18R)-6-(furan-3-yl)-1,7,11,15,15-pentamethyl-5,14-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-18-yl] acetate |
|---|---|
| PubChem CID | 137323257 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [(1S,4S,11R,18R)-6-(furan-3-yl)-1,7,11,15,15-pentamethyl-5,14-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-18-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC2C(C)(C)C(=O)CC[C@]2(C)C2CCC3(C)C(c4ccoc4)C(=O)[C@H]4OC43[C@@]21C |
| InChI | InChI=1S/C28H36O6/c1-15(29)33-20-13-18-24(2,3)19(30)8-10-25(18,4)17-7-11-26(5)21(16-9-12-32-14-16)22(31)23-28(26,34-23)27(17,20)6/h9,12,14,17-18,20-21,23H,7-8,10-11,13H2,1-6H3/t17?,18?,20-,21?,23-,25-,26?,27+,28?/m1/s1 |
| InChIKey | GZPQICWQMUTNPV-KCUBXFMKSA-N |
| XLogP | 4.85 |
| TPSA | 86.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|