C30H42O6 — CID 58100828
[(1S,2R,4S,12S,15R,19R)-7-(furan-3-yl)-1,8,12,13,15,16,16-heptamethyl-5-oxo-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadecan-19-yl] acetate (PubChem CID 58100828) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is [(1S,2R,4S,12S,15R,19R)-7-(furan-3-yl)-1,8,12,13,15,16,16-heptamethyl-5-oxo-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadecan-19-yl] acetate.
| Compound Name | [(1S,2R,4S,12S,15R,19R)-7-(furan-3-yl)-1,8,12,13,15,16,16-heptamethyl-5-oxo-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadecan-19-yl] acetate |
|---|---|
| PubChem CID | 58100828 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | [(1S,2R,4S,12S,15R,19R)-7-(furan-3-yl)-1,8,12,13,15,16,16-heptamethyl-5-oxo-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadecan-19-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC2C(C)(C)[C@H](C)CC(C)[C@]2(C)C2CCC3(C)C(c4ccoc4)OC(=O)[C@H]4O[C@]43[C@@]21C |
| InChI | InChI=1S/C30H42O6/c1-16-13-17(2)28(7)20-9-11-27(6)23(19-10-12-33-15-19)35-25(32)24-30(27,36-24)29(20,8)22(34-18(3)31)14-21(28)26(16,4)5/h10,12,15-17,20-24H,9,11,13-14H2,1-8H3/t16-,17?,20?,21?,22-,23?,24-,27?,28-,29+,30-/m1/s1 |
| InChIKey | NFBXXJCEABLNRJ-MUZCPGJDSA-N |
| XLogP | 6.10 |
| TPSA | 78.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|