C28H34O9 — CID 101211609
[(1R,2R,7S,10R,12S,13R,14R,16S,19S,20S)-19-(furan-3-yl)-9,9,13,20-tetramethyl-5,17-dioxo-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosan-12-yl] acetate (PubChem CID 101211609) has the molecular formula C28H34O9 and a molecular weight of 514.57 g/mol. Its IUPAC name is [(1R,2R,7S,10R,12S,13R,14R,16S,19S,20S)-19-(furan-3-yl)-9,9,13,20-tetramethyl-5,17-dioxo-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosan-12-yl] acetate.
| Compound Name | [(1R,2R,7S,10R,12S,13R,14R,16S,19S,20S)-19-(furan-3-yl)-9,9,13,20-tetramethyl-5,17-dioxo-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosan-12-yl] acetate |
|---|---|
| PubChem CID | 101211609 |
| Molecular Formula | C28H34O9 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | [(1R,2R,7S,10R,12S,13R,14R,16S,19S,20S)-19-(furan-3-yl)-9,9,13,20-tetramethyl-5,17-dioxo-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosan-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2C(C)(C)O[C@H]3CC(=O)OC[C@]32[C@H]2CC[C@@]3(C)[C@H](c4ccoc4)OC(=O)[C@H]4O[C@]43[C@@]12C |
| InChI | InChI=1S/C28H34O9/c1-14(29)34-18-10-17-24(2,3)36-19-11-20(30)33-13-27(17,19)16-6-8-25(4)21(15-7-9-32-12-15)35-23(31)22-28(25,37-22)26(16,18)5/h7,9,12,16-19,21-22H,6,8,10-11,13H2,1-5H3/t16-,17-,18-,19-,21-,22+,25-,26+,27+,28+/m0/s1 |
| InChIKey | WQDRZTIUAGZBQW-TZEXIHBXSA-N |
| XLogP | 3.50 |
| TPSA | 113.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|