C28H36O6 — CID 163099337
methyl 2-[5-(furan-3-yl)-6,10,12,12-tetramethyl-16-methylidene-3,13-dioxo-4-oxatetracyclo[7.6.1.110,14.01,6]heptadecan-11-yl]acetate (PubChem CID 163099337) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is methyl 2-[5-(furan-3-yl)-6,10,12,12-tetramethyl-16-methylidene-3,13-dioxo-4-oxatetracyclo[7.6.1.110,14.01,6]heptadecan-11-yl]acetate.
| Compound Name | methyl 2-[5-(furan-3-yl)-6,10,12,12-tetramethyl-16-methylidene-3,13-dioxo-4-oxatetracyclo[7.6.1.110,14.01,6]heptadecan-11-yl]acetate |
|---|---|
| PubChem CID | 163099337 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | methyl 2-[5-(furan-3-yl)-6,10,12,12-tetramethyl-16-methylidene-3,13-dioxo-4-oxatetracyclo[7.6.1.110,14.01,6]heptadecan-11-yl]acetate |
| SMILES | C=C1C2CCC3(C)C(c4ccoc4)OC(=O)CC13CC1CC2(C)C(CC(=O)OC)C(C)(C)C1=O |
| InChI | InChI=1S/C28H36O6/c1-16-19-7-9-27(5)24(17-8-10-33-15-17)34-22(30)14-28(16,27)13-18-12-26(19,4)20(11-21(29)32-6)25(2,3)23(18)31/h8,10,15,18-20,24H,1,7,9,11-14H2,2-6H3 |
| InChIKey | GIYOCRCZXRGSAB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|