C29H38O10 — CID 24882296
methyl 2-[(1S,3S,5S,7R,8S,10R,14R,15S)-5-acetyloxy-15-(furan-3-yl)-10-hydroxy-6,6,8,14-tetramethyl-11,17-dioxo-2,16-dioxatetracyclo[8.8.0.01,14.03,8]octadecan-7-yl]acetate (PubChem CID 24882296) has the molecular formula C29H38O10 and a molecular weight of 546.61 g/mol. Its IUPAC name is methyl 2-[(1S,3S,5S,7R,8S,10R,14R,15S)-5-acetyloxy-15-(furan-3-yl)-10-hydroxy-6,6,8,14-tetramethyl-11,17-dioxo-2,16-dioxatetracyclo[8.8.0.01,14.03,8]octadecan-7-yl]acetate.
| Compound Name | methyl 2-[(1S,3S,5S,7R,8S,10R,14R,15S)-5-acetyloxy-15-(furan-3-yl)-10-hydroxy-6,6,8,14-tetramethyl-11,17-dioxo-2,16-dioxatetracyclo[8.8.0.01,14.03,8]octadecan-7-yl]acetate |
|---|---|
| PubChem CID | 24882296 |
| Molecular Formula | C29H38O10 |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | methyl 2-[(1S,3S,5S,7R,8S,10R,14R,15S)-5-acetyloxy-15-(furan-3-yl)-10-hydroxy-6,6,8,14-tetramethyl-11,17-dioxo-2,16-dioxatetracyclo[8.8.0.01,14.03,8]octadecan-7-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C(C)(C)[C@@H](OC(C)=O)C[C@@H]2O[C@@]34CC(=O)O[C@@H](c5ccoc5)[C@@]3(C)CCC(=O)[C@@]4(O)C[C@]21C |
| InChI | InChI=1S/C29H38O10/c1-16(30)37-20-12-21-26(4,18(25(20,2)3)11-22(32)35-6)15-28(34)19(31)7-9-27(5)24(17-8-10-36-14-17)38-23(33)13-29(27,28)39-21/h8,10,14,18,20-21,24,34H,7,9,11-13,15H2,1-6H3/t18-,20+,21+,24+,26+,27-,28+,29+/m1/s1 |
| InChIKey | UHRURNYDVVBBBS-VUVYAIDJSA-N |
| XLogP | 3.44 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|