C31H38O11 — CID 102382759
methyl 2-[(1R,3S,5R,7S,8R,12S,13S)-5,10-diacetyloxy-13-(furan-3-yl)-6,6,8,12-tetramethyl-17-methylidene-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-7-yl]acetate (PubChem CID 102382759) has the molecular formula C31H38O11 and a molecular weight of 586.63 g/mol. Its IUPAC name is methyl 2-[(1R,3S,5R,7S,8R,12S,13S)-5,10-diacetyloxy-13-(furan-3-yl)-6,6,8,12-tetramethyl-17-methylidene-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-7-yl]acetate.
| Compound Name | methyl 2-[(1R,3S,5R,7S,8R,12S,13S)-5,10-diacetyloxy-13-(furan-3-yl)-6,6,8,12-tetramethyl-17-methylidene-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-7-yl]acetate |
|---|---|
| PubChem CID | 102382759 |
| Molecular Formula | C31H38O11 |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | methyl 2-[(1R,3S,5R,7S,8R,12S,13S)-5,10-diacetyloxy-13-(furan-3-yl)-6,6,8,12-tetramethyl-17-methylidene-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-7-yl]acetate |
| SMILES | C=C1C2(OC(C)=O)C[C@@]3(C)[C@H](c4ccoc4)OC(=O)C[C@]13O[C@H]1C[C@@H](OC(C)=O)C(C)(C)[C@H](CC(=O)OC)[C@@]1(C)C2=O |
| InChI | InChI=1S/C31H38O11/c1-16-30(41-18(3)33)15-28(6)25(19-9-10-38-14-19)40-24(35)13-31(16,28)42-22-12-21(39-17(2)32)27(4,5)20(11-23(34)37-8)29(22,7)26(30)36/h9-10,14,20-22,25H,1,11-13,15H2,2-8H3/t20-,21+,22-,25-,28-,29+,30?,31-/m0/s1 |
| InChIKey | VBUVTRXWAVCMCB-MXSTUOSOSA-N |
| XLogP | 3.79 |
| TPSA | 144.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|