C31H40O10 — CID 162999881
methyl 2-[5,9-diacetyloxy-13-(furan-3-yl)-6,6,8,12-tetramethyl-17-methylidene-15-oxo-2,14-dioxatetracyclo[7.7.1.01,12.03,8]heptadecan-7-yl]acetate (PubChem CID 162999881) has the molecular formula C31H40O10 and a molecular weight of 572.65 g/mol. Its IUPAC name is methyl 2-[5,9-diacetyloxy-13-(furan-3-yl)-6,6,8,12-tetramethyl-17-methylidene-15-oxo-2,14-dioxatetracyclo[7.7.1.01,12.03,8]heptadecan-7-yl]acetate.
| Compound Name | methyl 2-[5,9-diacetyloxy-13-(furan-3-yl)-6,6,8,12-tetramethyl-17-methylidene-15-oxo-2,14-dioxatetracyclo[7.7.1.01,12.03,8]heptadecan-7-yl]acetate |
|---|---|
| PubChem CID | 162999881 |
| Molecular Formula | C31H40O10 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | methyl 2-[5,9-diacetyloxy-13-(furan-3-yl)-6,6,8,12-tetramethyl-17-methylidene-15-oxo-2,14-dioxatetracyclo[7.7.1.01,12.03,8]heptadecan-7-yl]acetate |
| SMILES | C=C1C23CC(=O)OC(c4ccoc4)C2(C)CCC1(OC(C)=O)C1(C)C(CC(OC(C)=O)C(C)(C)C1CC(=O)OC)O3 |
| InChI | InChI=1S/C31H40O10/c1-17-30(40-19(3)33)11-10-28(6)26(20-9-12-37-16-20)39-25(35)15-31(17,28)41-23-14-22(38-18(2)32)27(4,5)21(29(23,30)7)13-24(34)36-8/h9,12,16,21-23,26H,1,10-11,13-15H2,2-8H3 |
| InChIKey | GKLYCNACONTFTG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 127.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|