C31H40O11 — CID 16742797
methyl 2-[(1R,3R,4R,5S,7S,8R,9S,12S,13S)-4,5-diacetyloxy-13-(furan-3-yl)-9-hydroxy-6,6,8,12-tetramethyl-17-methylidene-15-oxo-2,14-dioxatetracyclo[7.7.1.01,12.03,8]heptadecan-7-yl]acetate (PubChem CID 16742797) has the molecular formula C31H40O11 and a molecular weight of 588.65 g/mol. Its IUPAC name is methyl 2-[(1R,3R,4R,5S,7S,8R,9S,12S,13S)-4,5-diacetyloxy-13-(furan-3-yl)-9-hydroxy-6,6,8,12-tetramethyl-17-methylidene-15-oxo-2,14-dioxatetracyclo[7.7.1.01,12.03,8]heptadecan-7-yl]acetate.
| Compound Name | methyl 2-[(1R,3R,4R,5S,7S,8R,9S,12S,13S)-4,5-diacetyloxy-13-(furan-3-yl)-9-hydroxy-6,6,8,12-tetramethyl-17-methylidene-15-oxo-2,14-dioxatetracyclo[7.7.1.01,12.03,8]heptadecan-7-yl]acetate |
|---|---|
| PubChem CID | 16742797 |
| Molecular Formula | C31H40O11 |
| Molecular Weight | 588.65 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | methyl 2-[(1R,3R,4R,5S,7S,8R,9S,12S,13S)-4,5-diacetyloxy-13-(furan-3-yl)-9-hydroxy-6,6,8,12-tetramethyl-17-methylidene-15-oxo-2,14-dioxatetracyclo[7.7.1.01,12.03,8]heptadecan-7-yl]acetate |
| SMILES | C=C1[C@]2(O)CC[C@@]3(C)[C@H](c4ccoc4)OC(=O)C[C@]13O[C@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)C(C)(C)[C@H](CC(=O)OC)[C@]12C |
| InChI | InChI=1S/C31H40O11/c1-16-30(36)11-10-28(6)24(19-9-12-38-15-19)41-22(35)14-31(16,28)42-26-23(39-17(2)32)25(40-18(3)33)27(4,5)20(29(26,30)7)13-21(34)37-8/h9,12,15,20,23-26,36H,1,10-11,13-14H2,2-8H3/t20-,23-,24-,25+,26-,28-,29+,30+,31-/m0/s1 |
| InChIKey | WIZOVKYMIQNPQP-LPVNRPTQSA-N |
| XLogP | 3.58 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|