C33H42O13 — CID 178037346
methyl 2-[16,22-diacetyloxy-5-(furan-3-yl)-15-hydroxy-4,12,17,19-tetramethyl-7-oxo-6,11,13,20-tetraoxahexacyclo[10.7.1.110,15.117,19.01,10.04,9]docosan-18-yl]acetate (PubChem CID 178037346) has the molecular formula C33H42O13 and a molecular weight of 646.69 g/mol. Its IUPAC name is methyl 2-[16,22-diacetyloxy-5-(furan-3-yl)-15-hydroxy-4,12,17,19-tetramethyl-7-oxo-6,11,13,20-tetraoxahexacyclo[10.7.1.110,15.117,19.01,10.04,9]docosan-18-yl]acetate.
| Compound Name | methyl 2-[16,22-diacetyloxy-5-(furan-3-yl)-15-hydroxy-4,12,17,19-tetramethyl-7-oxo-6,11,13,20-tetraoxahexacyclo[10.7.1.110,15.117,19.01,10.04,9]docosan-18-yl]acetate |
|---|---|
| PubChem CID | 178037346 |
| Molecular Formula | C33H42O13 |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | methyl 2-[16,22-diacetyloxy-5-(furan-3-yl)-15-hydroxy-4,12,17,19-tetramethyl-7-oxo-6,11,13,20-tetraoxahexacyclo[10.7.1.110,15.117,19.01,10.04,9]docosan-18-yl]acetate |
| SMILES | COC(=O)CC1C2(C)CC1(C)C13CCC4(C)C(c5ccoc5)OC(=O)CC4C14OC(C)(OCC(O)(C2OC(C)=O)C4OC(C)=O)O3 |
| InChI | InChI=1S/C33H42O13/c1-17(34)42-25-28(4)15-29(5,20(28)12-22(36)39-7)32-10-9-27(3)21(13-23(37)44-24(27)19-8-11-40-14-19)33(32)26(43-18(2)35)31(25,38)16-41-30(6,45-32)46-33/h8,11,14,20-21,24-26,38H,9-10,12-13,15-16H2,1-7H3 |
| InChIKey | BUVUUYGCZYAUNR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 166.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|