C29H38O11 — CID 163023532
methyl 2-[14-acetyloxy-6-(furan-3-yl)-15,16-dihydroxy-7,11,13,13-tetramethyl-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadecan-12-yl]-2-hydroxyacetate (PubChem CID 163023532) has the molecular formula C29H38O11 and a molecular weight of 562.61 g/mol. Its IUPAC name is methyl 2-[14-acetyloxy-6-(furan-3-yl)-15,16-dihydroxy-7,11,13,13-tetramethyl-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadecan-12-yl]-2-hydroxyacetate.
| Compound Name | methyl 2-[14-acetyloxy-6-(furan-3-yl)-15,16-dihydroxy-7,11,13,13-tetramethyl-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadecan-12-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 163023532 |
| Molecular Formula | C29H38O11 |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | methyl 2-[14-acetyloxy-6-(furan-3-yl)-15,16-dihydroxy-7,11,13,13-tetramethyl-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadecan-12-yl]-2-hydroxyacetate |
| SMILES | COC(=O)C(O)C1C(C)(C)C(OC(C)=O)C2(O)CC34OC2(O)C1(C)C3CCC1(C)C(c2ccoc2)OC(=O)CC14 |
| InChI | InChI=1S/C29H38O11/c1-14(30)38-23-24(2,3)20(19(32)22(33)36-6)26(5)16-7-9-25(4)17(27(16)13-28(23,34)29(26,35)40-27)11-18(31)39-21(25)15-8-10-37-12-15/h8,10,12,16-17,19-21,23,32,34-35H,7,9,11,13H2,1-6H3 |
| InChIKey | ZKGNGSWVMAHGRU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 161.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|