C34H42O12 — CID 72783834
[15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-1-hydroxy-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] 2-methylbut-2-enoate (PubChem CID 72783834) has the molecular formula C34H42O12 and a molecular weight of 642.70 g/mol. Its IUPAC name is [15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-1-hydroxy-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] 2-methylbut-2-enoate.
| Compound Name | [15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-1-hydroxy-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 72783834 |
| Molecular Formula | C34H42O12 |
| Molecular Weight | 642.70 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | [15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-1-hydroxy-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(C)(C)C(C(OC(C)=O)C(=O)OC)C2(C)C(=O)C1(O)C1OC13C1CC(=O)OC(c4ccoc4)C1(C)CCC23 |
| InChI | InChI=1S/C34H42O12/c1-9-16(2)25(37)45-28-30(4,5)23(22(26(38)41-8)43-17(3)35)32(7)19-10-12-31(6)20(34(19)29(46-34)33(28,40)27(32)39)14-21(36)44-24(31)18-11-13-42-15-18/h9,11,13,15,19-20,22-24,28-29,40H,10,12,14H2,1-8H3 |
| InChIKey | CYIZQHWSHNNMLB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 168.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|