C32H40O11 — CID 14587336
[15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] propanoate (PubChem CID 14587336) has the molecular formula C32H40O11 and a molecular weight of 600.66 g/mol. Its IUPAC name is [15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] propanoate.
| Compound Name | [15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] propanoate |
|---|---|
| PubChem CID | 14587336 |
| Molecular Formula | C32H40O11 |
| Molecular Weight | 600.66 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | [15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] propanoate |
| SMILES | CCC(=O)OC1C2C(=O)C(C)(C(C(OC(C)=O)C(=O)OC)C1(C)C)C1CCC3(C)C(c4ccoc4)OC(=O)CC3C13OC23 |
| InChI | InChI=1S/C32H40O11/c1-8-19(34)41-26-21-24(36)31(6,23(29(26,3)4)22(28(37)38-7)40-15(2)33)17-9-11-30(5)18(32(17)27(21)43-32)13-20(35)42-25(30)16-10-12-39-14-16/h10,12,14,17-18,21-23,25-27H,8-9,11,13H2,1-7H3 |
| InChIKey | RZHCWHKYSBLXTK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 147.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|