C33H40O10 — CID 163113279
[16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-11-en-14-yl] 2-methylprop-2-enoate (PubChem CID 163113279) has the molecular formula C33H40O10 and a molecular weight of 596.67 g/mol. Its IUPAC name is [16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-11-en-14-yl] 2-methylprop-2-enoate.
| Compound Name | [16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-11-en-14-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163113279 |
| Molecular Formula | C33H40O10 |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | [16-(1-acetyloxy-2-methoxy-2-oxoethyl)-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-11-en-14-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C2C=C3C4CC(=O)OC(c5ccoc5)C4(C)CCC3C(C)(C2=O)C(C(OC(C)=O)C(=O)OC)C1(C)C |
| InChI | InChI=1S/C33H40O10/c1-16(2)29(37)43-28-20-13-19-21(9-11-32(6)22(19)14-23(35)42-27(32)18-10-12-40-15-18)33(7,26(20)36)25(31(28,4)5)24(30(38)39-8)41-17(3)34/h10,12-13,15,20-22,24-25,27-28H,1,9,11,14H2,2-8H3 |
| InChIKey | RWHXGCJPMSMUMM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 135.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|