C33H42O11 — CID 14587339
[15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] 2-methylpropanoate (PubChem CID 14587339) has the molecular formula C33H42O11 and a molecular weight of 614.69 g/mol. Its IUPAC name is [15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] 2-methylpropanoate.
| Compound Name | [15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 14587339 |
| Molecular Formula | C33H42O11 |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | [15-(1-acetyloxy-2-methoxy-2-oxoethyl)-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] 2-methylpropanoate |
| SMILES | COC(=O)C(OC(C)=O)C1C(C)(C)C(OC(=O)C(C)C)C2C(=O)C1(C)C1CCC3(C)C(c4ccoc4)OC(=O)CC3C13OC23 |
| InChI | InChI=1S/C33H42O11/c1-15(2)28(37)43-26-21-24(36)32(7,23(30(26,4)5)22(29(38)39-8)41-16(3)34)18-9-11-31(6)19(33(18)27(21)44-33)13-20(35)42-25(31)17-10-12-40-14-17/h10,12,14-15,18-19,21-23,25-27H,9,11,13H2,1-8H3 |
| InChIKey | QYPFXVUHMQMXKU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 147.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|