C30H38O9 — CID 163107159
[9-(furan-3-yl)-15-(2-methoxy-2-oxoethyl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] propanoate (PubChem CID 163107159) has the molecular formula C30H38O9 and a molecular weight of 542.63 g/mol. Its IUPAC name is [9-(furan-3-yl)-15-(2-methoxy-2-oxoethyl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] propanoate.
| Compound Name | [9-(furan-3-yl)-15-(2-methoxy-2-oxoethyl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] propanoate |
|---|---|
| PubChem CID | 163107159 |
| Molecular Formula | C30H38O9 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | [9-(furan-3-yl)-15-(2-methoxy-2-oxoethyl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadecan-17-yl] propanoate |
| SMILES | CCC(=O)OC1C2C(=O)C(C)(C(CC(=O)OC)C1(C)C)C1CCC3(C)C(c4ccoc4)OC(=O)CC3C13OC23 |
| InChI | InChI=1S/C30H38O9/c1-7-19(31)37-25-22-23(34)29(5,17(27(25,2)3)12-20(32)35-6)16-8-10-28(4)18(30(16)26(22)39-30)13-21(33)38-24(28)15-9-11-36-14-15/h9,11,14,16-18,22,24-26H,7-8,10,12-13H2,1-6H3 |
| InChIKey | AKZXBVCIZLNUMX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 121.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|