C31H36O11 — CID 163112241
methyl 2-acetyloxy-2-[17-acetyloxy-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadec-5-en-15-yl]acetate (PubChem CID 163112241) has the molecular formula C31H36O11 and a molecular weight of 584.62 g/mol. Its IUPAC name is methyl 2-acetyloxy-2-[17-acetyloxy-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadec-5-en-15-yl]acetate.
| Compound Name | methyl 2-acetyloxy-2-[17-acetyloxy-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadec-5-en-15-yl]acetate |
|---|---|
| PubChem CID | 163112241 |
| Molecular Formula | C31H36O11 |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | methyl 2-acetyloxy-2-[17-acetyloxy-9-(furan-3-yl)-10,14,16,16-tetramethyl-7,18-dioxo-3,8-dioxapentacyclo[12.3.1.02,4.04,13.05,10]octadec-5-en-15-yl]acetate |
| SMILES | COC(=O)C(OC(C)=O)C1C(C)(C)C(OC(C)=O)C2C(=O)C1(C)C1CCC3(C)C(=CC(=O)OC3c3ccoc3)C13OC23 |
| InChI | InChI=1S/C31H36O11/c1-14(32)39-21(27(36)37-7)22-28(3,4)25(40-15(2)33)20-23(35)30(22,6)17-8-10-29(5)18(31(17)26(20)42-31)12-19(34)41-24(29)16-9-11-38-13-16/h9,11-13,17,20-22,24-26H,8,10H2,1-7H3 |
| InChIKey | PHSVQRWCWMTFOW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 147.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|