C32H42O9 — CID 51398107
[(1R,4bR,5R,6aS,8R,10S,10aS,10bR,12aR)-8,10-diacetyloxy-1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isochromen-5-yl] acetate (PubChem CID 51398107) has the molecular formula C32H42O9 and a molecular weight of 570.68 g/mol. Its IUPAC name is [(1R,4bR,5R,6aS,8R,10S,10aS,10bR,12aR)-8,10-diacetyloxy-1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isochromen-5-yl] acetate.
| Compound Name | [(1R,4bR,5R,6aS,8R,10S,10aS,10bR,12aR)-8,10-diacetyloxy-1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isochromen-5-yl] acetate |
|---|---|
| PubChem CID | 51398107 |
| Molecular Formula | C32H42O9 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | [(1R,4bR,5R,6aS,8R,10S,10aS,10bR,12aR)-8,10-diacetyloxy-1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isochromen-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](OC(C)=O)C(C)(C)[C@@H]2C[C@@H](OC(C)=O)[C@@]3(C)C4=CC(=O)O[C@@H](c5ccoc5)[C@]4(C)CC[C@@H]3[C@@]12C |
| InChI | InChI=1S/C32H42O9/c1-17(33)38-24-15-26(40-19(3)35)31(7)21-9-11-30(6)23(14-27(36)41-28(30)20-10-12-37-16-20)32(21,8)25(39-18(2)34)13-22(31)29(24,4)5/h10,12,14,16,21-22,24-26,28H,9,11,13,15H2,1-8H3/t21-,22+,24-,25-,26+,28+,30-,31-,32-/m1/s1 |
| InChIKey | SUQFMFHTLHMZNM-FZMHWDDMSA-N |
| XLogP | 5.48 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|