C28H36O5 — CID 90686010
[1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,10b,11,12-octahydronaphtho[2,1-f]isochromen-5-yl] acetate (PubChem CID 90686010) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is [1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,10b,11,12-octahydronaphtho[2,1-f]isochromen-5-yl] acetate.
| Compound Name | [1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,10b,11,12-octahydronaphtho[2,1-f]isochromen-5-yl] acetate |
|---|---|
| PubChem CID | 90686010 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | [1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,10b,11,12-octahydronaphtho[2,1-f]isochromen-5-yl] acetate |
| SMILES | CC(=O)OC1CC2C(C)(C)CC=CC2(C)C2CCC3(C)C(=CC(=O)OC3c3ccoc3)C12C |
| InChI | InChI=1S/C28H36O5/c1-17(29)32-22-14-20-25(2,3)10-7-11-26(20,4)19-8-12-27(5)21(28(19,22)6)15-23(30)33-24(27)18-9-13-31-16-18/h7,9,11,13,15-16,19-20,22,24H,8,10,12,14H2,1-6H3 |
| InChIKey | ULQNTXLEKTYCKB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|