C29H36O5 — CID 163070224
[17-(furan-3-yl)-1,4,4,8,10,13-hexamethyl-3,16-dioxo-6,7,9,11,12,17-hexahydro-5H-cyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 163070224) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is [17-(furan-3-yl)-1,4,4,8,10,13-hexamethyl-3,16-dioxo-6,7,9,11,12,17-hexahydro-5H-cyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [17-(furan-3-yl)-1,4,4,8,10,13-hexamethyl-3,16-dioxo-6,7,9,11,12,17-hexahydro-5H-cyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 163070224 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | [17-(furan-3-yl)-1,4,4,8,10,13-hexamethyl-3,16-dioxo-6,7,9,11,12,17-hexahydro-5H-cyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | CC(=O)OC1CC2C(C)(C)C(=O)C=C(C)C2(C)C2CCC3(C)C(=CC(=O)C3c3ccoc3)C12C |
| InChI | InChI=1S/C29H36O5/c1-16-12-23(32)26(3,4)21-14-24(34-17(2)30)29(7)20(28(16,21)6)8-10-27(5)22(29)13-19(31)25(27)18-9-11-33-15-18/h9,11-13,15,20-21,24-25H,8,10,14H2,1-7H3 |
| InChIKey | KNOGSODQMVSFAW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |