C30H42O6 — CID 14781516
[1-acetyloxy-17-(furan-3-yl)-3-hydroxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 14781516) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is [1-acetyloxy-17-(furan-3-yl)-3-hydroxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [1-acetyloxy-17-(furan-3-yl)-3-hydroxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 14781516 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | [1-acetyloxy-17-(furan-3-yl)-3-hydroxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | CC(=O)OC1CC2C(C)(C)C(O)CC(OC(C)=O)C2(C)C2CCC3(C)C(=CCC3c3ccoc3)C12C |
| InChI | InChI=1S/C30H42O6/c1-17(31)35-25-14-23-27(3,4)24(33)15-26(36-18(2)32)30(23,7)22-10-12-28(5)20(19-11-13-34-16-19)8-9-21(28)29(22,25)6/h9,11,13,16,20,22-26,33H,8,10,12,14-15H2,1-7H3 |
| InChIKey | XZSOANLYLXCHQM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|