C28H34O7 — CID 59226789
[(2R,10R,11R,16S,17S)-16-(furan-3-yl)-2,7,7,11,17-pentamethyl-6,14-dioxo-4,15-dioxapentacyclo[9.8.0.02,8.03,5.012,17]nonadec-12-en-10-yl] acetate (PubChem CID 59226789) has the molecular formula C28H34O7 and a molecular weight of 482.57 g/mol. Its IUPAC name is [(2R,10R,11R,16S,17S)-16-(furan-3-yl)-2,7,7,11,17-pentamethyl-6,14-dioxo-4,15-dioxapentacyclo[9.8.0.02,8.03,5.012,17]nonadec-12-en-10-yl] acetate.
| Compound Name | [(2R,10R,11R,16S,17S)-16-(furan-3-yl)-2,7,7,11,17-pentamethyl-6,14-dioxo-4,15-dioxapentacyclo[9.8.0.02,8.03,5.012,17]nonadec-12-en-10-yl] acetate |
|---|---|
| PubChem CID | 59226789 |
| Molecular Formula | C28H34O7 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [(2R,10R,11R,16S,17S)-16-(furan-3-yl)-2,7,7,11,17-pentamethyl-6,14-dioxo-4,15-dioxapentacyclo[9.8.0.02,8.03,5.012,17]nonadec-12-en-10-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC2C(C)(C)C(=O)C3OC3[C@]2(C)C2CC[C@@]3(C)C(=CC(=O)O[C@@H]3c3ccoc3)[C@@]21C |
| InChI | InChI=1S/C28H34O7/c1-14(29)33-19-11-17-25(2,3)22(31)21-24(35-21)28(17,6)16-7-9-26(4)18(27(16,19)5)12-20(30)34-23(26)15-8-10-32-13-15/h8,10,12-13,16-17,19,21,23-24H,7,9,11H2,1-6H3/t16?,17?,19-,21?,23-,24?,26+,27-,28-/m1/s1 |
| InChIKey | MUUQATOBEVXSBH-WFBGAPNQSA-N |
| XLogP | 4.56 |
| TPSA | 95.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|