C28H38O5 — CID 59226785
[(1R,4bR,10aS,12aR)-1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isochromen-5-yl] acetate (PubChem CID 59226785) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is [(1R,4bR,10aS,12aR)-1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isochromen-5-yl] acetate.
| Compound Name | [(1R,4bR,10aS,12aR)-1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isochromen-5-yl] acetate |
|---|---|
| PubChem CID | 59226785 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | [(1R,4bR,10aS,12aR)-1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3-oxo-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isochromen-5-yl] acetate |
| SMILES | CC(=O)OC1CC2C(C)(C)CCC[C@]2(C)C2CC[C@]3(C)C(=CC(=O)O[C@H]3c3ccoc3)[C@]12C |
| InChI | InChI=1S/C28H38O5/c1-17(29)32-22-14-20-25(2,3)10-7-11-26(20,4)19-8-12-27(5)21(28(19,22)6)15-23(30)33-24(27)18-9-13-31-16-18/h9,13,15-16,19-20,22,24H,7-8,10-12,14H2,1-6H3/t19?,20?,22?,24-,26+,27+,28+/m0/s1 |
| InChIKey | KHARQKXCINHICJ-LHXKDUPASA-N |
| XLogP | 6.39 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |