C30H38O6 — CID 162952807
[11-acetyloxy-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 162952807) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is [11-acetyloxy-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [11-acetyloxy-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 162952807 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | [11-acetyloxy-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | CC(=O)OC1CC2(C)C(=CCC2c2ccoc2)C2(C)C(OC(C)=O)CC3C(C)(C)C(=O)C=CC3(C)C12 |
| InChI | InChI=1S/C30H38O6/c1-17(31)35-21-15-29(6)20(19-11-13-34-16-19)8-9-22(29)30(7)25(36-18(2)32)14-23-27(3,4)24(33)10-12-28(23,5)26(21)30/h9-13,16,20-21,23,25-26H,8,14-15H2,1-7H3 |
| InChIKey | WXRBQEJURWIRRB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|