C26H34O4 — CID 162852054
(5S,6R,7S,8R,9R,10R,13S,17R)-17-(furan-3-yl)-6,7-dihydroxy-4,4,8,10,13-pentamethyl-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 162852054) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (5S,6R,7S,8R,9R,10R,13S,17R)-17-(furan-3-yl)-6,7-dihydroxy-4,4,8,10,13-pentamethyl-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,6R,7S,8R,9R,10R,13S,17R)-17-(furan-3-yl)-6,7-dihydroxy-4,4,8,10,13-pentamethyl-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162852054 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (5S,6R,7S,8R,9R,10R,13S,17R)-17-(furan-3-yl)-6,7-dihydroxy-4,4,8,10,13-pentamethyl-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1(C)C(=O)C=C[C@@]2(C)[C@@H]1[C@@H](O)[C@@H](O)[C@@]1(C)C3=CC[C@@H](c4ccoc4)[C@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C26H34O4/c1-23(2)19(27)9-12-25(4)18-8-11-24(3)16(15-10-13-30-14-15)6-7-17(24)26(18,5)22(29)20(28)21(23)25/h7,9-10,12-14,16,18,20-22,28-29H,6,8,11H2,1-5H3/t16-,18+,20+,21+,22+,24-,25+,26-/m0/s1 |
| InChIKey | WZPANUTWHFNPFJ-OBSKZAHGSA-N |
| XLogP | 4.64 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|