C26H28O4 — CID 163039061
6-(furan-3-yl)-1,5,10,15-tetramethyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-8,12(19),16-triene-11,18-dione (PubChem CID 163039061) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 6-(furan-3-yl)-1,5,10,15-tetramethyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-8,12(19),16-triene-11,18-dione.
| Compound Name | 6-(furan-3-yl)-1,5,10,15-tetramethyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-8,12(19),16-triene-11,18-dione |
|---|---|
| PubChem CID | 163039061 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 6-(furan-3-yl)-1,5,10,15-tetramethyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-8,12(19),16-triene-11,18-dione |
| SMILES | CC12C=CC(=O)C3(C)C1=C(OC2)C(=O)C1(C)C2=CCC(c4ccoc4)C2(C)CCC13 |
| InChI | InChI=1S/C26H28O4/c1-23-10-8-19(27)26(4)18-7-11-24(2)16(15-9-12-29-13-15)5-6-17(24)25(18,3)22(28)20(21(23)26)30-14-23/h6,8-10,12-13,16,18H,5,7,11,14H2,1-4H3 |
| InChIKey | MHHWKYUSJKVZMV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|