C26H30O3 — CID 78114870
6-(furan-3-yl)-1,5,10,15-tetramethyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-8,11,16-trien-18-one (PubChem CID 78114870) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is 6-(furan-3-yl)-1,5,10,15-tetramethyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-8,11,16-trien-18-one.
| Compound Name | 6-(furan-3-yl)-1,5,10,15-tetramethyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-8,11,16-trien-18-one |
|---|---|
| PubChem CID | 78114870 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 6-(furan-3-yl)-1,5,10,15-tetramethyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-8,11,16-trien-18-one |
| SMILES | CC12C=CC(=O)C3(C)C1C(=CC1(C)C4=CCC(c5ccoc5)C4(C)CCC13)OC2 |
| InChI | InChI=1S/C26H30O3/c1-23-10-8-21(27)26(4)20-7-11-24(2)17(16-9-12-28-14-16)5-6-19(24)25(20,3)13-18(22(23)26)29-15-23/h6,8-10,12-14,17,20,22H,5,7,11,15H2,1-4H3 |
| InChIKey | ZDBMCXFUQGNBLR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|