C27H34O5 — CID 163031015
methyl 2-[3-(furan-3-yl)-3a,5b,7,7,10a-pentamethyl-8-oxo-2,3,4,5,5a,6-hexahydroindeno[4,5-b][1]benzofuran-6-yl]acetate (PubChem CID 163031015) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is methyl 2-[3-(furan-3-yl)-3a,5b,7,7,10a-pentamethyl-8-oxo-2,3,4,5,5a,6-hexahydroindeno[4,5-b][1]benzofuran-6-yl]acetate.
| Compound Name | methyl 2-[3-(furan-3-yl)-3a,5b,7,7,10a-pentamethyl-8-oxo-2,3,4,5,5a,6-hexahydroindeno[4,5-b][1]benzofuran-6-yl]acetate |
|---|---|
| PubChem CID | 163031015 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | methyl 2-[3-(furan-3-yl)-3a,5b,7,7,10a-pentamethyl-8-oxo-2,3,4,5,5a,6-hexahydroindeno[4,5-b][1]benzofuran-6-yl]acetate |
| SMILES | COC(=O)CC1C(C)(C)C(=O)C=C2OC3(C)C4=CCC(c5ccoc5)C4(C)CCC3C21C |
| InChI | InChI=1S/C27H34O5/c1-24(2)20(13-23(29)30-6)26(4)19-9-11-25(3)17(16-10-12-31-15-16)7-8-18(25)27(19,5)32-22(26)14-21(24)28/h8,10,12,14-15,17,19-20H,7,9,11,13H2,1-6H3 |
| InChIKey | NTPCLJXNFWPTEV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|