C24H28O5 — CID 177431225
(1S,2R,6R,7S,10S,11R,15R,16S,17R)-6-(furan-3-yl)-15,17-dihydroxy-2,7,11-trimethyl-18-oxapentacyclo[13.2.1.02,10.03,7.011,16]octadeca-3,13-dien-12-one (PubChem CID 177431225) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is (1S,2R,6R,7S,10S,11R,15R,16S,17R)-6-(furan-3-yl)-15,17-dihydroxy-2,7,11-trimethyl-18-oxapentacyclo[13.2.1.02,10.03,7.011,16]octadeca-3,13-dien-12-one.
| Compound Name | (1S,2R,6R,7S,10S,11R,15R,16S,17R)-6-(furan-3-yl)-15,17-dihydroxy-2,7,11-trimethyl-18-oxapentacyclo[13.2.1.02,10.03,7.011,16]octadeca-3,13-dien-12-one |
|---|---|
| PubChem CID | 177431225 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (1S,2R,6R,7S,10S,11R,15R,16S,17R)-6-(furan-3-yl)-15,17-dihydroxy-2,7,11-trimethyl-18-oxapentacyclo[13.2.1.02,10.03,7.011,16]octadeca-3,13-dien-12-one |
| SMILES | C[C@]12C3=CC[C@@H](c4ccoc4)[C@]3(C)CC[C@@H]1[C@@]1(C)C(=O)C=C[C@@]3(O)O[C@@H]2[C@H](O)[C@H]13 |
| InChI | InChI=1S/C24H28O5/c1-21-9-6-16-22(2,15(21)5-4-14(21)13-8-11-28-12-13)20-18(26)19-23(16,3)17(25)7-10-24(19,27)29-20/h5,7-8,10-12,14,16,18-20,26-27H,4,6,9H2,1-3H3/t14-,16-,18+,19+,20+,21-,22-,23-,24+/m0/s1 |
| InChIKey | LOEQMIOAFHHNBJ-RBKXBEFISA-N |
| XLogP | 3.34 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|