C26H32O5 — CID 132516272
(1R,2S,5S,6S,8S,10S,11S,12S,13R,16R,20S)-6-(furan-3-yl)-12-hydroxy-1,5,11,16-tetramethyl-9,14-dioxahexacyclo[11.6.1.02,11.05,10.08,10.016,20]icos-17-en-19-one (PubChem CID 132516272) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is (1R,2S,5S,6S,8S,10S,11S,12S,13R,16R,20S)-6-(furan-3-yl)-12-hydroxy-1,5,11,16-tetramethyl-9,14-dioxahexacyclo[11.6.1.02,11.05,10.08,10.016,20]icos-17-en-19-one.
| Compound Name | (1R,2S,5S,6S,8S,10S,11S,12S,13R,16R,20S)-6-(furan-3-yl)-12-hydroxy-1,5,11,16-tetramethyl-9,14-dioxahexacyclo[11.6.1.02,11.05,10.08,10.016,20]icos-17-en-19-one |
|---|---|
| PubChem CID | 132516272 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (1R,2S,5S,6S,8S,10S,11S,12S,13R,16R,20S)-6-(furan-3-yl)-12-hydroxy-1,5,11,16-tetramethyl-9,14-dioxahexacyclo[11.6.1.02,11.05,10.08,10.016,20]icos-17-en-19-one |
| SMILES | C[C@@]12C(=O)C=C[C@@]3(C)CO[C@@H]([C@@H](O)[C@]4(C)[C@@H]1CC[C@@]1(C)[C@H](c5ccoc5)C[C@@H]5O[C@]541)[C@H]23 |
| InChI | InChI=1S/C26H32O5/c1-22-8-6-17(27)24(3)16-5-9-23(2)15(14-7-10-29-12-14)11-18-26(23,31-18)25(16,4)21(28)19(20(22)24)30-13-22/h6-8,10,12,15-16,18-21,28H,5,9,11,13H2,1-4H3/t15-,16+,18-,19+,20-,21+,22-,23-,24-,25-,26-/m0/s1 |
| InChIKey | SFWDSXUZFJRHBZ-ADTXSRINSA-N |
| XLogP | 3.87 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|