C30H36O7 — CID 163066868
[7-(furan-3-yl)-1,6,12,17-tetramethyl-20-oxo-3,10,15-trioxaheptacyclo[12.6.1.02,4.02,12.06,11.09,11.017,21]henicos-18-en-13-yl] 2-methylpropanoate (PubChem CID 163066868) has the molecular formula C30H36O7 and a molecular weight of 508.61 g/mol. Its IUPAC name is [7-(furan-3-yl)-1,6,12,17-tetramethyl-20-oxo-3,10,15-trioxaheptacyclo[12.6.1.02,4.02,12.06,11.09,11.017,21]henicos-18-en-13-yl] 2-methylpropanoate.
| Compound Name | [7-(furan-3-yl)-1,6,12,17-tetramethyl-20-oxo-3,10,15-trioxaheptacyclo[12.6.1.02,4.02,12.06,11.09,11.017,21]henicos-18-en-13-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 163066868 |
| Molecular Formula | C30H36O7 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | [7-(furan-3-yl)-1,6,12,17-tetramethyl-20-oxo-3,10,15-trioxaheptacyclo[12.6.1.02,4.02,12.06,11.09,11.017,21]henicos-18-en-13-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1C2OCC3(C)C=CC(=O)C(C)(C23)C23OC2CC2(C)C(c4ccoc4)CC4OC42C13C |
| InChI | InChI=1S/C30H36O7/c1-15(2)24(32)35-23-21-22-25(3,14-34-21)9-7-18(31)27(22,5)30-20(37-30)12-26(4)17(16-8-10-33-13-16)11-19-29(26,36-19)28(23,30)6/h7-10,13,15,17,19-23H,11-12,14H2,1-6H3 |
| InChIKey | HBTNFPGRTANCNN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 90.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|