C29H34O7 — CID 71297197
[(1R,2R,4R,6S,7S,9R,10R,11R)-6-(furan-3-yl)-17-methoxy-1,7,11,15,15-pentamethyl-14,18-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadeca-12,16-dien-9-yl] acetate (PubChem CID 71297197) has the molecular formula C29H34O7 and a molecular weight of 494.58 g/mol. Its IUPAC name is [(1R,2R,4R,6S,7S,9R,10R,11R)-6-(furan-3-yl)-17-methoxy-1,7,11,15,15-pentamethyl-14,18-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadeca-12,16-dien-9-yl] acetate.
| Compound Name | [(1R,2R,4R,6S,7S,9R,10R,11R)-6-(furan-3-yl)-17-methoxy-1,7,11,15,15-pentamethyl-14,18-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadeca-12,16-dien-9-yl] acetate |
|---|---|
| PubChem CID | 71297197 |
| Molecular Formula | C29H34O7 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | [(1R,2R,4R,6S,7S,9R,10R,11R)-6-(furan-3-yl)-17-methoxy-1,7,11,15,15-pentamethyl-14,18-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadeca-12,16-dien-9-yl] acetate |
| SMILES | COC1=C2C(C)(C)C(=O)C=C[C@]2(C)[C@H]2[C@H](OC(C)=O)C[C@@]3(C)[C@H](c4ccoc4)C[C@H]4O[C@]43[C@]2(C)C1=O |
| InChI | InChI=1S/C29H34O7/c1-15(30)35-18-13-27(5)17(16-9-11-34-14-16)12-20-29(27,36-20)28(6)22(18)26(4)10-8-19(31)25(2,3)23(26)21(33-7)24(28)32/h8-11,14,17-18,20,22H,12-13H2,1-7H3/t17-,18+,20+,22+,26+,27-,28-,29+/m0/s1 |
| InChIKey | QKNUMVHALYTJQK-MIDIMEQDSA-N |
| XLogP | 4.52 |
| TPSA | 95.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|