C27H34O7 — CID 71297195
(1R,2R,4R,6S,7S,9R,10R,11R)-6-(furan-3-yl)-9,17-dihydroxy-12-methoxy-1,7,11,15,15-pentamethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-16-ene-14,18-dione (PubChem CID 71297195) has the molecular formula C27H34O7 and a molecular weight of 470.56 g/mol. Its IUPAC name is (1R,2R,4R,6S,7S,9R,10R,11R)-6-(furan-3-yl)-9,17-dihydroxy-12-methoxy-1,7,11,15,15-pentamethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-16-ene-14,18-dione.
| Compound Name | (1R,2R,4R,6S,7S,9R,10R,11R)-6-(furan-3-yl)-9,17-dihydroxy-12-methoxy-1,7,11,15,15-pentamethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-16-ene-14,18-dione |
|---|---|
| PubChem CID | 71297195 |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (1R,2R,4R,6S,7S,9R,10R,11R)-6-(furan-3-yl)-9,17-dihydroxy-12-methoxy-1,7,11,15,15-pentamethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-16-ene-14,18-dione |
| SMILES | COC1CC(=O)C(C)(C)C2=C(O)C(=O)[C@]3(C)[C@H]([C@H](O)C[C@@]4(C)[C@H](c5ccoc5)C[C@H]5O[C@]543)[C@]21C |
| InChI | InChI=1S/C27H34O7/c1-23(2)16(29)10-17(32-6)25(4)20-15(28)11-24(3)14(13-7-8-33-12-13)9-18-27(24,34-18)26(20,5)22(31)19(30)21(23)25/h7-8,12,14-15,17-18,20,28,30H,9-11H2,1-6H3/t14-,15+,17?,18+,20+,24-,25+,26-,27+/m0/s1 |
| InChIKey | ASAORVRABQSVMG-LNIVHQMCSA-N |
| XLogP | 3.71 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|