C26H32O9 — CID 124870856
(1R,2S,4R,7S,8R,10R,11R,12S,13S,18S)-7-(furan-3-yl)-10,13-dihydroxy-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosane-5,15,20-trione (PubChem CID 124870856) has the molecular formula C26H32O9 and a molecular weight of 488.53 g/mol. Its IUPAC name is (1R,2S,4R,7S,8R,10R,11R,12S,13S,18S)-7-(furan-3-yl)-10,13-dihydroxy-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosane-5,15,20-trione.
| Compound Name | (1R,2S,4R,7S,8R,10R,11R,12S,13S,18S)-7-(furan-3-yl)-10,13-dihydroxy-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosane-5,15,20-trione |
|---|---|
| PubChem CID | 124870856 |
| Molecular Formula | C26H32O9 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | (1R,2S,4R,7S,8R,10R,11R,12S,13S,18S)-7-(furan-3-yl)-10,13-dihydroxy-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosane-5,15,20-trione |
| SMILES | CC1(C)OC(=O)C[C@H](O)[C@]2(C)[C@@H]1CC(=O)[C@]1(C)[C@@H]2[C@H](O)C[C@]2(C)[C@H](c3ccoc3)OC(=O)[C@@H]3O[C@@]321 |
| InChI | InChI=1S/C26H32O9/c1-22(2)14-8-16(29)25(5)18(24(14,4)15(28)9-17(30)34-22)13(27)10-23(3)19(12-6-7-32-11-12)33-21(31)20-26(23,25)35-20/h6-7,11,13-15,18-20,27-28H,8-10H2,1-5H3/t13-,14-,15+,18-,19+,20+,23-,24+,25-,26+/m1/s1 |
| InChIKey | ITMCBHIQGZAEPX-MJUBUCAASA-N |
| XLogP | 2.09 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|