C28H34O12 — CID 162818936
[10-hydroxy-7-(2-hydroxy-5-oxo-2H-furan-3-yl)-1,8,12,17,17-pentamethyl-5,15,20-trioxo-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosan-13-yl] acetate (PubChem CID 162818936) has the molecular formula C28H34O12 and a molecular weight of 562.57 g/mol. Its IUPAC name is [10-hydroxy-7-(2-hydroxy-5-oxo-2H-furan-3-yl)-1,8,12,17,17-pentamethyl-5,15,20-trioxo-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosan-13-yl] acetate.
| Compound Name | [10-hydroxy-7-(2-hydroxy-5-oxo-2H-furan-3-yl)-1,8,12,17,17-pentamethyl-5,15,20-trioxo-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosan-13-yl] acetate |
|---|---|
| PubChem CID | 162818936 |
| Molecular Formula | C28H34O12 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | [10-hydroxy-7-(2-hydroxy-5-oxo-2H-furan-3-yl)-1,8,12,17,17-pentamethyl-5,15,20-trioxo-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosan-13-yl] acetate |
| SMILES | CC(=O)OC1CC(=O)OC(C)(C)C2CC(=O)C3(C)C(C(O)CC4(C)C(C5=CC(=O)OC5O)OC(=O)C5OC543)C12C |
| InChI | InChI=1S/C28H34O12/c1-11(29)36-16-9-18(33)39-24(2,3)14-8-15(31)27(6)19(26(14,16)5)13(30)10-25(4)20(12-7-17(32)37-22(12)34)38-23(35)21-28(25,27)40-21/h7,13-14,16,19-22,30,34H,8-10H2,1-6H3 |
| InChIKey | QGDFSEAUGUCXGE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 175.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|