C26H32O10 — CID 73236888
13-hydroxy-7-(2-hydroxy-5-oxo-2H-furan-4-yl)-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosane-5,15,20-trione (PubChem CID 73236888) has the molecular formula C26H32O10 and a molecular weight of 504.53 g/mol. Its IUPAC name is 13-hydroxy-7-(2-hydroxy-5-oxo-2H-furan-4-yl)-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosane-5,15,20-trione.
| Compound Name | 13-hydroxy-7-(2-hydroxy-5-oxo-2H-furan-4-yl)-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosane-5,15,20-trione |
|---|---|
| PubChem CID | 73236888 |
| Molecular Formula | C26H32O10 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 13-hydroxy-7-(2-hydroxy-5-oxo-2H-furan-4-yl)-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icosane-5,15,20-trione |
| SMILES | CC1(C)OC(=O)CC(O)C2(C)C1CC(=O)C1(C)C2CCC2(C)C(C3=CC(O)OC3=O)OC(=O)C3OC321 |
| InChI | InChI=1S/C26H32O10/c1-22(2)13-9-15(28)25(5)12(24(13,4)14(27)10-17(30)35-22)6-7-23(3)18(11-8-16(29)33-20(11)31)34-21(32)19-26(23,25)36-19/h8,12-14,16,18-19,27,29H,6-7,9-10H2,1-5H3 |
| InChIKey | PHVHHFHIPAQRPP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|