C28H36O10 — CID 10816101
[4-[(1R,2R,4S,7R,8S,11R,12R,13S)-13-methoxy-1,8,12,13,15,15-hexamethyl-5,18-dioxo-3,6,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-7-yl]-5-oxo-2H-furan-2-yl] acetate (PubChem CID 10816101) has the molecular formula C28H36O10 and a molecular weight of 532.59 g/mol. Its IUPAC name is [4-[(1R,2R,4S,7R,8S,11R,12R,13S)-13-methoxy-1,8,12,13,15,15-hexamethyl-5,18-dioxo-3,6,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-7-yl]-5-oxo-2H-furan-2-yl] acetate.
| Compound Name | [4-[(1R,2R,4S,7R,8S,11R,12R,13S)-13-methoxy-1,8,12,13,15,15-hexamethyl-5,18-dioxo-3,6,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-7-yl]-5-oxo-2H-furan-2-yl] acetate |
|---|---|
| PubChem CID | 10816101 |
| Molecular Formula | C28H36O10 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | [4-[(1R,2R,4S,7R,8S,11R,12R,13S)-13-methoxy-1,8,12,13,15,15-hexamethyl-5,18-dioxo-3,6,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-7-yl]-5-oxo-2H-furan-2-yl] acetate |
| SMILES | CO[C@@]1(C)OC(C)(C)C2CC(=O)[C@]3(C)[C@H](CC[C@@]4(C)[C@H](C5=CC(OC(C)=O)OC5=O)OC(=O)[C@H]5O[C@]543)[C@]21C |
| InChI | InChI=1S/C28H36O10/c1-13(29)34-18-11-14(21(31)35-18)19-24(4)10-9-15-25(5)16(23(2,3)38-27(25,7)33-8)12-17(30)26(15,6)28(24)20(37-28)22(32)36-19/h11,15-16,18-20H,9-10,12H2,1-8H3/t15-,16?,18?,19+,20-,24+,25-,26+,27+,28-/m1/s1 |
| InChIKey | INQLPJIMVQXLLZ-UMJZZPDHSA-N |
| XLogP | 2.61 |
| TPSA | 126.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|