C26H30O8 — CID 163191019
(1R,2R,7S,10R,13R,14R,16S,19R,20S)-19-(furan-2-yl)-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,12,17-trione (PubChem CID 163191019) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is (1R,2R,7S,10R,13R,14R,16S,19R,20S)-19-(furan-2-yl)-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,12,17-trione.
| Compound Name | (1R,2R,7S,10R,13R,14R,16S,19R,20S)-19-(furan-2-yl)-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,12,17-trione |
|---|---|
| PubChem CID | 163191019 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | (1R,2R,7S,10R,13R,14R,16S,19R,20S)-19-(furan-2-yl)-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,12,17-trione |
| SMILES | CC1(C)O[C@H]2CC(=O)OC[C@]23[C@H]2CC[C@@]4(C)[C@H](c5ccco5)OC(=O)[C@H]5O[C@]54[C@]2(C)C(=O)C[C@@H]13 |
| InChI | InChI=1S/C26H30O8/c1-22(2)15-10-16(27)24(4)14(25(15)12-31-18(28)11-17(25)33-22)7-8-23(3)19(13-6-5-9-30-13)32-21(29)20-26(23,24)34-20/h5-6,9,14-15,17,19-20H,7-8,10-12H2,1-4H3/t14-,15-,17-,19-,20+,23-,24-,25+,26+/m0/s1 |
| InChIKey | KXGIFPWCBBIRIU-MSGMIQHVSA-N |
| XLogP | 3.14 |
| TPSA | 104.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|