C27H34O8 — CID 153496777
(1R,2R,7S,10R,13R,14R,15S,18S,19S)-18-(furan-3-yl)-14-hydroxy-9,9,13,15,19-pentamethyl-4,8,17-trioxapentacyclo[11.8.0.02,7.02,10.014,19]henicosane-5,12,16-trione (PubChem CID 153496777) has the molecular formula C27H34O8 and a molecular weight of 486.56 g/mol. Its IUPAC name is (1R,2R,7S,10R,13R,14R,15S,18S,19S)-18-(furan-3-yl)-14-hydroxy-9,9,13,15,19-pentamethyl-4,8,17-trioxapentacyclo[11.8.0.02,7.02,10.014,19]henicosane-5,12,16-trione.
| Compound Name | (1R,2R,7S,10R,13R,14R,15S,18S,19S)-18-(furan-3-yl)-14-hydroxy-9,9,13,15,19-pentamethyl-4,8,17-trioxapentacyclo[11.8.0.02,7.02,10.014,19]henicosane-5,12,16-trione |
|---|---|
| PubChem CID | 153496777 |
| Molecular Formula | C27H34O8 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (1R,2R,7S,10R,13R,14R,15S,18S,19S)-18-(furan-3-yl)-14-hydroxy-9,9,13,15,19-pentamethyl-4,8,17-trioxapentacyclo[11.8.0.02,7.02,10.014,19]henicosane-5,12,16-trione |
| SMILES | C[C@@H]1C(=O)O[C@@H](c2ccoc2)[C@]2(C)CC[C@@H]3[C@@]45COC(=O)C[C@@H]4OC(C)(C)[C@@H]5CC(=O)[C@@]3(C)[C@@]12O |
| InChI | InChI=1S/C27H34O8/c1-14-22(30)34-21(15-7-9-32-12-15)24(4)8-6-16-25(5,27(14,24)31)18(28)10-17-23(2,3)35-19-11-20(29)33-13-26(16,17)19/h7,9,12,14,16-17,19,21,31H,6,8,10-11,13H2,1-5H3/t14-,16+,17+,19+,21+,24+,25+,26-,27-/m1/s1 |
| InChIKey | AOKFPTMKZUXXQJ-KLOFYHGTSA-N |
| XLogP | 3.37 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |