C30H38O9 — CID 162947986
[(1S,2R,7R,10S,11R,13R,14S,15S,18S,19S)-18-(furan-3-yl)-9,9,13,14,15,19-hexamethyl-5,12,16-trioxo-4,8,17-trioxapentacyclo[11.8.0.02,7.02,10.014,19]henicosan-11-yl] acetate (PubChem CID 162947986) has the molecular formula C30H38O9 and a molecular weight of 542.63 g/mol. Its IUPAC name is [(1S,2R,7R,10S,11R,13R,14S,15S,18S,19S)-18-(furan-3-yl)-9,9,13,14,15,19-hexamethyl-5,12,16-trioxo-4,8,17-trioxapentacyclo[11.8.0.02,7.02,10.014,19]henicosan-11-yl] acetate.
| Compound Name | [(1S,2R,7R,10S,11R,13R,14S,15S,18S,19S)-18-(furan-3-yl)-9,9,13,14,15,19-hexamethyl-5,12,16-trioxo-4,8,17-trioxapentacyclo[11.8.0.02,7.02,10.014,19]henicosan-11-yl] acetate |
|---|---|
| PubChem CID | 162947986 |
| Molecular Formula | C30H38O9 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | [(1S,2R,7R,10S,11R,13R,14S,15S,18S,19S)-18-(furan-3-yl)-9,9,13,14,15,19-hexamethyl-5,12,16-trioxo-4,8,17-trioxapentacyclo[11.8.0.02,7.02,10.014,19]henicosan-11-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)[C@]2(C)[C@@H](CC[C@]3(C)[C@@H](c4ccoc4)OC(=O)[C@@H](C)[C@@]32C)[C@@]23COC(=O)C[C@H]2OC(C)(C)[C@H]13 |
| InChI | InChI=1S/C30H38O9/c1-15-25(34)38-24(17-9-11-35-13-17)27(5)10-8-18-28(6,29(15,27)7)23(33)21(37-16(2)31)22-26(3,4)39-19-12-20(32)36-14-30(18,19)22/h9,11,13,15,18-19,21-22,24H,8,10,12,14H2,1-7H3/t15-,18-,19-,21-,22+,24-,27-,28+,29+,30+/m1/s1 |
| InChIKey | FSKJPUQWULKKGE-FDNGNFJDSA-N |
| XLogP | 4.18 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|