C26H30O7 — CID 162953763
(1R,2R,4S,7R,8S,12R,18R)-7-(furan-2-yl)-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15,20-trione (PubChem CID 162953763) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is (1R,2R,4S,7R,8S,12R,18R)-7-(furan-2-yl)-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15,20-trione.
| Compound Name | (1R,2R,4S,7R,8S,12R,18R)-7-(furan-2-yl)-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15,20-trione |
|---|---|
| PubChem CID | 162953763 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (1R,2R,4S,7R,8S,12R,18R)-7-(furan-2-yl)-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15,20-trione |
| SMILES | CC1(C)OC(=O)C=C[C@]2(C)C3CC[C@@]4(C)[C@H](c5ccco5)OC(=O)[C@H]5O[C@]54[C@]3(C)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C26H30O7/c1-22(2)16-13-17(27)25(5)15(23(16,3)10-9-18(28)32-22)8-11-24(4)19(14-7-6-12-30-14)31-21(29)20-26(24,25)33-20/h6-7,9-10,12,15-16,19-20H,8,11,13H2,1-5H3/t15?,16-,19-,20+,23+,24-,25-,26+/m0/s1 |
| InChIKey | VSLDMVSILHVDSR-LLWDQIFWSA-N |
| XLogP | 3.92 |
| TPSA | 95.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|