C26H32O7 — CID 90661950
(1S,2R,4S,7R,8S,12R,20R)-7-(furan-3-yl)-20-hydroxy-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15-dione (PubChem CID 90661950) has the molecular formula C26H32O7 and a molecular weight of 456.54 g/mol. Its IUPAC name is (1S,2R,4S,7R,8S,12R,20R)-7-(furan-3-yl)-20-hydroxy-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15-dione.
| Compound Name | (1S,2R,4S,7R,8S,12R,20R)-7-(furan-3-yl)-20-hydroxy-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15-dione |
|---|---|
| PubChem CID | 90661950 |
| Molecular Formula | C26H32O7 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (1S,2R,4S,7R,8S,12R,20R)-7-(furan-3-yl)-20-hydroxy-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15-dione |
| SMILES | CC1(C)OC(=O)C=C[C@@]2(C)C1C[C@@H](O)[C@]1(C)C2CC[C@@]2(C)[C@@H](c3ccoc3)OC(=O)[C@H]3O[C@]321 |
| InChI | InChI=1S/C26H32O7/c1-22(2)16-12-17(27)25(5)15(23(16,3)9-7-18(28)32-22)6-10-24(4)19(14-8-11-30-13-14)31-21(29)20-26(24,25)33-20/h7-9,11,13,15-17,19-20,27H,6,10,12H2,1-5H3/t15?,16?,17-,19-,20-,23-,24+,25+,26-/m1/s1 |
| InChIKey | ADZYDUJXHKLXCN-PVECIELMSA-N |
| XLogP | 3.72 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|