C26H32O7 — CID 163051739
(1R,2R,4S,7S,8R,11R,12S,13R,15S,20S)-7-(furan-3-yl)-20-hydroxy-1,8,12,17,17-pentamethyl-3,6,14-trioxahexacyclo[9.9.0.02,4.02,8.012,18.013,15]icosane-5,16-dione (PubChem CID 163051739) has the molecular formula C26H32O7 and a molecular weight of 456.54 g/mol. Its IUPAC name is (1R,2R,4S,7S,8R,11R,12S,13R,15S,20S)-7-(furan-3-yl)-20-hydroxy-1,8,12,17,17-pentamethyl-3,6,14-trioxahexacyclo[9.9.0.02,4.02,8.012,18.013,15]icosane-5,16-dione.
| Compound Name | (1R,2R,4S,7S,8R,11R,12S,13R,15S,20S)-7-(furan-3-yl)-20-hydroxy-1,8,12,17,17-pentamethyl-3,6,14-trioxahexacyclo[9.9.0.02,4.02,8.012,18.013,15]icosane-5,16-dione |
|---|---|
| PubChem CID | 163051739 |
| Molecular Formula | C26H32O7 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (1R,2R,4S,7S,8R,11R,12S,13R,15S,20S)-7-(furan-3-yl)-20-hydroxy-1,8,12,17,17-pentamethyl-3,6,14-trioxahexacyclo[9.9.0.02,4.02,8.012,18.013,15]icosane-5,16-dione |
| SMILES | CC1(C)C(=O)[C@H]2O[C@@H]2[C@]2(C)C1C[C@H](O)[C@@]1(C)[C@@H]2CC[C@]2(C)[C@H](c3ccoc3)OC(=O)[C@H]3O[C@@]312 |
| InChI | InChI=1S/C26H32O7/c1-22(2)14-10-15(27)25(5)13(24(14,4)19-16(31-19)17(22)28)6-8-23(3)18(12-7-9-30-11-12)32-21(29)20-26(23,25)33-20/h7,9,11,13-16,18-20,27H,6,8,10H2,1-5H3/t13-,14?,15+,16-,18+,19+,20-,23-,24+,25-,26-/m1/s1 |
| InChIKey | UIUKQADPLSFRBN-BSBWPLKFSA-N |
| XLogP | 3.20 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|