C28H34O9 — CID 162880216
[(1S,2R,4S,7S,8S,10S,12R,18R,20R)-7-(furan-3-yl)-10-hydroxy-1,8,12,17,17-pentamethyl-5,15-dioxo-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-en-20-yl] acetate (PubChem CID 162880216) has the molecular formula C28H34O9 and a molecular weight of 514.57 g/mol. Its IUPAC name is [(1S,2R,4S,7S,8S,10S,12R,18R,20R)-7-(furan-3-yl)-10-hydroxy-1,8,12,17,17-pentamethyl-5,15-dioxo-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-en-20-yl] acetate.
| Compound Name | [(1S,2R,4S,7S,8S,10S,12R,18R,20R)-7-(furan-3-yl)-10-hydroxy-1,8,12,17,17-pentamethyl-5,15-dioxo-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-en-20-yl] acetate |
|---|---|
| PubChem CID | 162880216 |
| Molecular Formula | C28H34O9 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | [(1S,2R,4S,7S,8S,10S,12R,18R,20R)-7-(furan-3-yl)-10-hydroxy-1,8,12,17,17-pentamethyl-5,15-dioxo-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-en-20-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2C(C)(C)OC(=O)C=C[C@]2(C)C2C(O)C[C@@]3(C)[C@H](c4ccoc4)OC(=O)[C@H]4O[C@]43[C@@]21C |
| InChI | InChI=1S/C28H34O9/c1-14(29)34-18-11-17-24(2,3)36-19(31)7-9-25(17,4)20-16(30)12-26(5)21(15-8-10-33-13-15)35-23(32)22-28(26,37-22)27(18,20)6/h7-10,13,16-18,20-22,30H,11-12H2,1-6H3/t16?,17-,18+,20?,21-,22+,25-,26-,27+,28+/m0/s1 |
| InChIKey | LQJDEKSQQRKNEE-GKJJXFRQSA-N |
| XLogP | 3.26 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|