C29H36O10 — CID 162467882
acetyl 2-[(1R,2R,4S,7R,8S,11R,12R,13S,16R)-7-(2-hydroxy-5-oxo-2H-furan-3-yl)-1,8,12,15,15-pentamethyl-5,18-dioxo-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-13-yl]acetate (PubChem CID 162467882) has the molecular formula C29H36O10 and a molecular weight of 544.60 g/mol. Its IUPAC name is acetyl 2-[(1R,2R,4S,7R,8S,11R,12R,13S,16R)-7-(2-hydroxy-5-oxo-2H-furan-3-yl)-1,8,12,15,15-pentamethyl-5,18-dioxo-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-13-yl]acetate.
| Compound Name | acetyl 2-[(1R,2R,4S,7R,8S,11R,12R,13S,16R)-7-(2-hydroxy-5-oxo-2H-furan-3-yl)-1,8,12,15,15-pentamethyl-5,18-dioxo-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-13-yl]acetate |
|---|---|
| PubChem CID | 162467882 |
| Molecular Formula | C29H36O10 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | acetyl 2-[(1R,2R,4S,7R,8S,11R,12R,13S,16R)-7-(2-hydroxy-5-oxo-2H-furan-3-yl)-1,8,12,15,15-pentamethyl-5,18-dioxo-3,14-dioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-13-yl]acetate |
| SMILES | CC(=O)OC(=O)C[C@@H]1OC(C)(C)[C@@H]2CC(=O)[C@]3(C)[C@H](CC[C@@]4(C)[C@H](C5=CC(=O)OC5O)CC(=O)[C@H]5O[C@]543)[C@@]12C |
| InChI | InChI=1S/C29H36O10/c1-13(30)36-22(34)12-20-27(5)17-7-8-26(4)15(14-9-21(33)37-24(14)35)10-16(31)23-29(26,39-23)28(17,6)19(32)11-18(27)25(2,3)38-20/h9,15,17-18,20,23-24,35H,7-8,10-12H2,1-6H3/t15-,17+,18-,20-,23+,24?,26-,27+,28-,29+/m0/s1 |
| InChIKey | KRPJJMNHBOFMFM-BQUNFLBWSA-N |
| XLogP | 2.19 |
| TPSA | 145.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|