C26H32O4 — CID 126500263
6-(furan-3-yl)-17-hydroxy-1,7,11,15,15-pentamethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadeca-12,16-dien-14-one (PubChem CID 126500263) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is 6-(furan-3-yl)-17-hydroxy-1,7,11,15,15-pentamethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadeca-12,16-dien-14-one.
| Compound Name | 6-(furan-3-yl)-17-hydroxy-1,7,11,15,15-pentamethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadeca-12,16-dien-14-one |
|---|---|
| PubChem CID | 126500263 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 6-(furan-3-yl)-17-hydroxy-1,7,11,15,15-pentamethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadeca-12,16-dien-14-one |
| SMILES | CC1(C)C(=O)C=CC2(C)C1=C(O)CC1(C)C2CCC2(C)C(c3ccoc3)CC3OC321 |
| InChI | InChI=1S/C26H32O4/c1-22(2)19(28)7-9-23(3)18-6-10-24(4)16(15-8-11-29-14-15)12-20-26(24,30-20)25(18,5)13-17(27)21(22)23/h7-9,11,14,16,18,20,27H,6,10,12-13H2,1-5H3 |
| InChIKey | HKKBSVNUECNLSF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|