C33H38O4 — CID 162880289
[(5R,7R,8R,9R,10R,13S,17R)-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] benzoate (PubChem CID 162880289) has the molecular formula C33H38O4 and a molecular weight of 498.66 g/mol. Its IUPAC name is [(5R,7R,8R,9R,10R,13S,17R)-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] benzoate.
| Compound Name | [(5R,7R,8R,9R,10R,13S,17R)-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] benzoate |
|---|---|
| PubChem CID | 162880289 |
| Molecular Formula | C33H38O4 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | [(5R,7R,8R,9R,10R,13S,17R)-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] benzoate |
| SMILES | CC1(C)C(=O)C=C[C@]2(C)[C@H]3CC[C@]4(C)C(=CC[C@H]4c4ccoc4)[C@]3(C)[C@H](OC(=O)c3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C33H38O4/c1-30(2)26-19-28(37-29(35)21-9-7-6-8-10-21)33(5)24-12-11-23(22-15-18-36-20-22)31(24,3)16-13-25(33)32(26,4)17-14-27(30)34/h6-10,12,14-15,17-18,20,23,25-26,28H,11,13,16,19H2,1-5H3/t23-,25+,26-,28+,31-,32+,33-/m0/s1 |
| InChIKey | VNLNOVUTBGMAAB-CKQMGGGASA-N |
| XLogP | 7.53 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|