C32H40O6 — CID 162904585
[(5S,7R,8R,9R,10R,13R,17R)-17-hydroxy-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 162904585) has the molecular formula C32H40O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is [(5S,7R,8R,9R,10R,13R,17R)-17-hydroxy-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [(5S,7R,8R,9R,10R,13R,17R)-17-hydroxy-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162904585 |
| Molecular Formula | C32H40O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | [(5S,7R,8R,9R,10R,13R,17R)-17-hydroxy-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)O[C@@H]2C[C@@H]3C(C)(C)C(=O)C=C[C@]3(C)[C@H]3CC[C@]4(C)C(=CC[C@H]4O)[C@@]32C)cc1O |
| InChI | InChI=1S/C32H40O6/c1-29(2)24-18-27(38-28(36)12-8-19-7-9-21(37-6)20(33)17-19)32(5)22-10-11-26(35)31(22,4)15-13-23(32)30(24,3)16-14-25(29)34/h7-10,12,14,16-17,23-24,26-27,33,35H,11,13,15,18H2,1-6H3/t23-,24-,26-,27-,30-,31-,32+/m1/s1 |
| InChIKey | NGOJDIUUBAMSFW-ZJALLJMXSA-N |
| XLogP | 5.63 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|