C25H36O5 — CID 163016032
[(1R,2S,4aR,8S,8aS)-8-hydroxy-4a,8-dimethyl-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 163016032) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is [(1R,2S,4aR,8S,8aS)-8-hydroxy-4a,8-dimethyl-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [(1R,2S,4aR,8S,8aS)-8-hydroxy-4a,8-dimethyl-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163016032 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | [(1R,2S,4aR,8S,8aS)-8-hydroxy-4a,8-dimethyl-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)O[C@H]2[C@@H]3[C@](C)(CCC[C@]3(C)O)CC[C@H]2C(C)C)cc1O |
| InChI | InChI=1S/C25H36O5/c1-16(2)18-11-14-24(3)12-6-13-25(4,28)23(24)22(18)30-21(27)10-8-17-7-9-20(29-5)19(26)15-17/h7-10,15-16,18,22-23,26,28H,6,11-14H2,1-5H3/t18-,22+,23+,24+,25-/m0/s1 |
| InChIKey | QKFIDIQJEROXCT-CWVZODRYSA-N |
| XLogP | 4.95 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|