C24H34O4 — CID 162915314
(4,8-dihydroxy-4a,8-dimethyl-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl) 3-phenylprop-2-enoate (PubChem CID 162915314) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is (4,8-dihydroxy-4a,8-dimethyl-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl) 3-phenylprop-2-enoate.
| Compound Name | (4,8-dihydroxy-4a,8-dimethyl-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162915314 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (4,8-dihydroxy-4a,8-dimethyl-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl) 3-phenylprop-2-enoate |
| SMILES | CC(C)C1CC(O)C2(C)CCCC(C)(O)C2C1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C24H34O4/c1-16(2)18-15-19(25)23(3)13-8-14-24(4,27)22(23)21(18)28-20(26)12-11-17-9-6-5-7-10-17/h5-7,9-12,16,18-19,21-22,25,27H,8,13-15H2,1-4H3 |
| InChIKey | WIIMMGRJVZSVRB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|